4-(1-Methylcyclopropyl)aniline hydrochloride, 98%, 98%
cas: 2172473-99-1 — see every product listed under this CAS number, including other names
4-(1-Methylcyclopropyl)aniline hydrochloride, 98%, 98% (CAS 2172473-99-1) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FJBL-50mg |
| cas | 2172473-99-1 |
| size | 50mg |
| availability | 15g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 784.40 Pln | |
| Chemat | 100mg | 1082.00 Pln | |
| Chemat | 250mg | 1643.60 Pln | |
| Chemat | 1g | 4134.80 Pln | |
| Chemat | 5g | 11757.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-(1-methylcyclopropyl)aniline;hydrochloride (CAS 2172473-99-1) is a chemical compound with the molecular formula C10H14ClN and a molecular weight of 183.68 g/mol. IUPAC name: 4-(1-methylcyclopropyl)aniline;hydrochloride. InChIKey: AXEHZAXXZVCVEO-UHFFFAOYSA-N.
| Molecular formula | C10H14ClN |
|---|---|
| Molecular weight | 183.68 g/mol |
| IUPAC name | 4-(1-methylcyclopropyl)aniline;hydrochloride |
| InChIKey | AXEHZAXXZVCVEO-UHFFFAOYSA-N |
| SMILES | CC1(CC1)C2=CC=C(C=C2)N.Cl |
Computed by PubChem (NCBI)