cas: 859833-22-0 — see every product listed under this CAS number, including other names
4-(1-Piperidinylmethyl)benzeneboronic acid pinacol ester, 95-<97% (CAS 859833-22-0) is a chemical reagent available from Chemat. Available pack sizes: 25g, 50g, 100g, 200g, 300g, 400g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC85-95-97-25g |
| cas | 859833-22-0 |
| size | 25g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 25g | 4799.52 Pln | |
| Hoffman Fine Chemicals | 50g | 7491.88 Pln | |
| Hoffman Fine Chemicals | 100g | 11804.76 Pln | |
| Hoffman Fine Chemicals | 200g | 18701.54 Pln | |
| Hoffman Fine Chemicals | 300g | 25138.96 Pln | |
| Hoffman Fine Chemicals | 400g | 30102.60 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperidine (CAS 859833-22-0) is a chemical compound with the molecular formula C18H28BNO2 and a molecular weight of 301.2 g/mol. IUPAC name: 1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperidine. InChIKey: HJKVRMHVLINDRH-UHFFFAOYSA-N.
| Molecular formula | C18H28BNO2 |
|---|---|
| Molecular weight | 301.2 g/mol |
| IUPAC name | 1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperidine |
| InChIKey | HJKVRMHVLINDRH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)CN3CCCCC3 |
Computed by PubChem (NCBI)