cas: 1139-46-4 — see every product listed under this CAS number, including other names
4-(2,4,4-Trimethylpentan-2-yl)benzene-1,2-diol 95% (CAS 1139-46-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1219688-250mg |
| cas | 1139-46-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 409.31 Pln | |
| Ambeed | 1g | 987.81 Pln | |
| Ambeed | 5g | 3268.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1219688 |
4-(2,4,4-trimethylpentan-2-yl)benzene-1,2-diol (CAS 1139-46-4) is a chemical compound with the molecular formula C14H22O2 and a molecular weight of 222.32 g/mol. IUPAC name: 4-(2,4,4-trimethylpentan-2-yl)benzene-1,2-diol. InChIKey: BOTKTAZUSYVSFF-UHFFFAOYSA-N.
| Molecular formula | C14H22O2 |
|---|---|
| Molecular weight | 222.32 g/mol |
| IUPAC name | 4-(2,4,4-trimethylpentan-2-yl)benzene-1,2-diol |
| InChIKey | BOTKTAZUSYVSFF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC(C)(C)C1=CC(=C(C=C1)O)O |
Computed by PubChem (NCBI)