cas: 65300-53-0 — see every product listed under this CAS number, including other names
4-(2-(4-Nitrophenoxy)ethyl)morpholine, 98%, 98% (CAS 65300-53-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EBN8-5g |
| cas | 65300-53-0 |
| size | 5g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 141.20 Pln | |
| Chemat | 25g | 338.00 Pln | |
| Chemat | 100g | 1067.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-[2-(4-nitrophenoxy)ethyl]morpholine (CAS 65300-53-0) is a chemical compound with the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. IUPAC name: 4-[2-(4-nitrophenoxy)ethyl]morpholine. InChIKey: BERKHGFFGHNCSO-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O4 |
|---|---|
| Molecular weight | 252.27 g/mol |
| IUPAC name | 4-[2-(4-nitrophenoxy)ethyl]morpholine |
| InChIKey | BERKHGFFGHNCSO-UHFFFAOYSA-N |
| SMILES | C1COCCN1CCOC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)