CAS 62234-40-6 appears in our catalog under these names: Z-Dab-oh, 98%, Z–Dab–OH, Z-L-Dab-OH, Cbz-Dab-OH 98%, N-alpha-Cbz-L-2,4-diaminobutyric acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Ambeed, Chemat. Available pack sizes: 1g, 10g, 25g, 100g, 5g, 500g.
(2S)-4-amino-2-(phenylmethoxycarbonylamino)butanoic acid (CAS 62234-40-6) is a chemical compound with the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. IUPAC name: (2S)-4-amino-2-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: KXMSCBRTBLPGIN-JTQLQIEISA-N.
| Molecular formula | C12H16N2O4 |
|---|---|
| Molecular weight | 252.27 g/mol |
| IUPAC name | (2S)-4-amino-2-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | KXMSCBRTBLPGIN-JTQLQIEISA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@@H](CCN)C(=O)O |
Computed by PubChem (NCBI)