CAS 96935-86-3 is the registry number for Methyl (2s)-2-(2-aminoacetamido)-3-(4-hydroxyphenyl)propanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g.
Methyl (2S)-2-[(2-aminoacetyl)amino]-3-(4-hydroxyphenyl)propanoate (CAS 96935-86-3) is a chemical compound with the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. IUPAC name: methyl (2S)-2-[(2-aminoacetyl)amino]-3-(4-hydroxyphenyl)propanoate. InChIKey: AEOOZNHTRCEWBN-JTQLQIEISA-N.
| Molecular formula | C12H16N2O4 |
|---|---|
| Molecular weight | 252.27 g/mol |
| IUPAC name | methyl (2S)-2-[(2-aminoacetyl)amino]-3-(4-hydroxyphenyl)propanoate |
| InChIKey | AEOOZNHTRCEWBN-JTQLQIEISA-N |
| SMILES | COC(=O)[C@H](CC1=CC=C(C=C1)O)NC(=O)CN |
Computed by PubChem (NCBI)