cas: 38948-27-5 — see every product listed under this CAS number, including other names
4-(2-(Piperidin-1-yl)ethoxy)aniline, 98%, 98% (CAS 38948-27-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11D4TM-250mg |
| cas | 38948-27-5 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 227.60 Pln | |
| Chemat | 1g | 534.80 Pln | |
| Chemat | 5g | 1816.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-(2-piperidin-1-ylethoxy)aniline (CAS 38948-27-5) is a chemical compound with the molecular formula C13H20N2O and a molecular weight of 220.31 g/mol. IUPAC name: 4-(2-piperidin-1-ylethoxy)aniline. InChIKey: VTBHKDHFDNLZNG-UHFFFAOYSA-N.
| Molecular formula | C13H20N2O |
|---|---|
| Molecular weight | 220.31 g/mol |
| IUPAC name | 4-(2-piperidin-1-ylethoxy)aniline |
| InChIKey | VTBHKDHFDNLZNG-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)CCOC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)