CAS 81882-74-8 is the registry number for 3-Amino-N,N-diisopropylbenzamide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g.
3-amino-N,N-di(propan-2-yl)benzamide (CAS 81882-74-8) is a chemical compound with the molecular formula C13H20N2O and a molecular weight of 220.31 g/mol. IUPAC name: 3-amino-N,N-di(propan-2-yl)benzamide. InChIKey: RUUVNNMTPOLLLQ-UHFFFAOYSA-N.
| Molecular formula | C13H20N2O |
|---|---|
| Molecular weight | 220.31 g/mol |
| IUPAC name | 3-amino-N,N-di(propan-2-yl)benzamide |
| InChIKey | RUUVNNMTPOLLLQ-UHFFFAOYSA-N |
| SMILES | CC(C)N(C(C)C)C(=O)C1=CC(=CC=C1)N |
Computed by PubChem (NCBI)