cas: 5038-59-5 — see every product listed under this CAS number, including other names
4-(2-Bromoacetyl)benzene-1-sulfonyl chloride 96% (CAS 5038-59-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A296724-5g |
| cas | 5038-59-5 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 9620.81 Pln | |
| Ambeed | 100mg | 592.88 Pln | |
| Ambeed | 250mg | 954.44 Pln | |
| Ambeed | 1g | 2456.31 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A296724 |
4-(2-bromoacetyl)benzenesulfonyl chloride (CAS 5038-59-5) is a chemical compound with the molecular formula C8H6BrClO3S and a molecular weight of 297.55 g/mol. IUPAC name: 4-(2-bromoacetyl)benzenesulfonyl chloride. InChIKey: YSZVEXHEBFFCSK-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClO3S |
|---|---|
| Molecular weight | 297.55 g/mol |
| IUPAC name | 4-(2-bromoacetyl)benzenesulfonyl chloride |
| InChIKey | YSZVEXHEBFFCSK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CBr)S(=O)(=O)Cl |
Computed by PubChem (NCBI)