Products 5038-59-5

CAS 5038-59-5 is the registry number for 4-(2-Bromoacetyl)benzenesulfonyl chloride, 96%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.

Structural formula: {0} (CAS {1})

4-(2-bromoacetyl)benzenesulfonyl chloride (CAS 5038-59-5) is a chemical compound with the molecular formula C8H6BrClO3S and a molecular weight of 297.55 g/mol. IUPAC name: 4-(2-bromoacetyl)benzenesulfonyl chloride. InChIKey: YSZVEXHEBFFCSK-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6BrClO3S
Molecular weight297.55 g/mol
IUPAC name4-(2-bromoacetyl)benzenesulfonyl chloride
InChIKeyYSZVEXHEBFFCSK-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C(=O)CBr)S(=O)(=O)Cl

Computed by PubChem (NCBI)