CAS 5038-59-5 appears in our catalog under these names: 4-(2-Bromoacetyl)benzenesulfonyl chloride, 96%, 4-(2-Bromoacetyl)benzene-1-sulfonyl chloride 96%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
4-(2-bromoacetyl)benzenesulfonyl chloride (CAS 5038-59-5) is a chemical compound with the molecular formula C8H6BrClO3S and a molecular weight of 297.55 g/mol. IUPAC name: 4-(2-bromoacetyl)benzenesulfonyl chloride. InChIKey: YSZVEXHEBFFCSK-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClO3S |
|---|---|
| Molecular weight | 297.55 g/mol |
| IUPAC name | 4-(2-bromoacetyl)benzenesulfonyl chloride |
| InChIKey | YSZVEXHEBFFCSK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CBr)S(=O)(=O)Cl |
Computed by PubChem (NCBI)