Products 690632-00-9

CAS 690632-00-9 appears in our catalog under these names: 5-Bromo-2,3-dihydrobenzo[b]furan-7-sulfonyl chloride, 95%, 5-Bromo-2,3-dihydrobenzofuran-7-sulfonyl chloride, 98%, 98%, 5-Bromo-2,3-dihydro-1-benzofuran-7-sulfonyl chloride, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 250mg, 1g, 10g, 25g, 500mg, 2.5g.

Structural formula: {0} (CAS {1})

5-bromo-2,3-dihydro-1-benzofuran-7-sulfonyl chloride (CAS 690632-00-9) is a chemical compound with the molecular formula C8H6BrClO3S and a molecular weight of 297.55 g/mol. IUPAC name: 5-bromo-2,3-dihydro-1-benzofuran-7-sulfonyl chloride. InChIKey: WDCSWTWTTAMPFJ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6BrClO3S
Molecular weight297.55 g/mol
IUPAC name5-bromo-2,3-dihydro-1-benzofuran-7-sulfonyl chloride
InChIKeyWDCSWTWTTAMPFJ-UHFFFAOYSA-N
SMILESC1COC2=C1C=C(C=C2S(=O)(=O)Cl)Br

Computed by PubChem (NCBI)