cas: 305801-12-1 — see every product listed under this CAS number, including other names
4-(2-Fluorophenoxy)aniline 98% (CAS 305801-12-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A690383-250mg |
| cas | 305801-12-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 264.69 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 882.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A690383 |
4-(2-fluorophenoxy)aniline (CAS 305801-12-1) is a chemical compound with the molecular formula C12H10FNO and a molecular weight of 203.21 g/mol. IUPAC name: 4-(2-fluorophenoxy)aniline. InChIKey: XOTBQGILYQQOKD-UHFFFAOYSA-N.
| Molecular formula | C12H10FNO |
|---|---|
| Molecular weight | 203.21 g/mol |
| IUPAC name | 4-(2-fluorophenoxy)aniline |
| InChIKey | XOTBQGILYQQOKD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OC2=CC=C(C=C2)N)F |
Computed by PubChem (NCBI)