CAS 613662-01-4 appears in our catalog under these names: 5-Fluoro-2-phenoxyaniline, 95%, 5-Fluoro-2-phenoxyaniline. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 2,5g, 250mg.
5-fluoro-2-phenoxyaniline (CAS 613662-01-4) is a chemical compound with the molecular formula C12H10FNO and a molecular weight of 203.21 g/mol. IUPAC name: 5-fluoro-2-phenoxyaniline. InChIKey: RMYDPTVQMJEGLG-UHFFFAOYSA-N.
| Molecular formula | C12H10FNO |
|---|---|
| Molecular weight | 203.21 g/mol |
| IUPAC name | 5-fluoro-2-phenoxyaniline |
| InChIKey | RMYDPTVQMJEGLG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=C(C=C(C=C2)F)N |
Computed by PubChem (NCBI)