4-(2-Fluorophenyl)butanoic acid, 95%
cas: 143654-62-0 — see every product listed under this CAS number, including other names
4-(2-Fluorophenyl)butanoic acid, 95% (CAS 143654-62-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A205711-250mg |
| cas | 143654-62-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 642.94 Pln | |
| Ambeed | 1g | 1210.31 Pln | |
| BLDpharm | 100mg | 497.63 Pln | |
| BLDpharm | 250mg | 686.45 Pln | |
| BLDpharm | 1g | 1302.90 Pln | |
| Chemat | 100mg | 568.40 Pln | |
| Chemat | 250mg | 914.00 Pln | |
| Chemat | 1g | 2363.60 Pln | |
| Fluorochem | 100mg | 1044.44 Pln | |
| Fluorochem | 250mg | 1684.84 Pln | |
| Fluorochem | 1g | 4371.40 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
4-(2-fluorophenyl)butanoic acid (CAS 143654-62-0) is a chemical compound with the molecular formula C10H11FO2 and a molecular weight of 182.19 g/mol. IUPAC name: 4-(2-fluorophenyl)butanoic acid. InChIKey: BFPNQUKYBZXOSL-UHFFFAOYSA-N.
| Molecular formula | C10H11FO2 |
|---|---|
| Molecular weight | 182.19 g/mol |
| IUPAC name | 4-(2-fluorophenyl)butanoic acid |
| InChIKey | BFPNQUKYBZXOSL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CCCC(=O)O)F |
Computed by PubChem (NCBI)