CAS 143654-62-0 appears in our catalog under these names: 4–(2–Fluorophenyl)butanoic acid, 4-(2-Fluorophenyl)butanoic acid, 95%, 95%, 4-(2-FLUOROPHENYL)BUTANOIC ACID, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
4-(2-fluorophenyl)butanoic acid (CAS 143654-62-0) is a chemical compound with the molecular formula C10H11FO2 and a molecular weight of 182.19 g/mol. IUPAC name: 4-(2-fluorophenyl)butanoic acid. InChIKey: BFPNQUKYBZXOSL-UHFFFAOYSA-N.
| Molecular formula | C10H11FO2 |
|---|---|
| Molecular weight | 182.19 g/mol |
| IUPAC name | 4-(2-fluorophenyl)butanoic acid |
| InChIKey | BFPNQUKYBZXOSL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CCCC(=O)O)F |
Computed by PubChem (NCBI)