cas: 96736-00-4 — see every product listed under this CAS number, including other names
4-(2-N-Boc-Hydrazino)Benzoic Acid 97% (CAS 96736-00-4) is a chemical reagent available from Chemat. Available pack sizes: 100g, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A112602-100g |
| cas | 96736-00-4 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 3908.12 Pln | |
| Ambeed | 250mg | 170.12 Pln | |
| Ambeed | 1g | 192.38 Pln | |
| Ambeed | 5g | 409.31 Pln | |
| Ambeed | 25g | 1271.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A112602 |
4-[2-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinyl]benzoic acid (CAS 96736-00-4) is a chemical compound with the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. IUPAC name: 4-[2-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinyl]benzoic acid. InChIKey: FRMCTSPNGUPJRR-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O4 |
|---|---|
| Molecular weight | 252.27 g/mol |
| IUPAC name | 4-[2-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinyl]benzoic acid |
| InChIKey | FRMCTSPNGUPJRR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NNC1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)