cas: 130312-10-6 — see every product listed under this CAS number, including other names
4-(2-Oxo-ethyl)-piperidine-1-carboxylic acid benzyl ester, 96%, 96% (CAS 130312-10-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111UA7-100mg |
| cas | 130312-10-6 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 443.60 Pln | |
| Chemat | 250mg | 717.20 Pln | |
| Chemat | 1g | 1754.00 Pln | |
| Chemat | 5g | 5138.00 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
Benzyl 4-(2-oxoethyl)piperidine-1-carboxylate (CAS 130312-10-6) is a chemical compound with the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. IUPAC name: benzyl 4-(2-oxoethyl)piperidine-1-carboxylate. InChIKey: SRDLYAHRIXBDKX-UHFFFAOYSA-N.
| Molecular formula | C15H19NO3 |
|---|---|
| Molecular weight | 261.32 g/mol |
| IUPAC name | benzyl 4-(2-oxoethyl)piperidine-1-carboxylate |
| InChIKey | SRDLYAHRIXBDKX-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1CC=O)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)