cas: 50609-01-3 — see every product listed under this CAS number, including other names
4-(2-Pyrrolidin-1-yl-ethoxy)-phenylamine, 98% (CAS 50609-01-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 2.5g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F037343-100MG |
| cas | 50609-01-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 268.67 Pln | |
| Fluorochem | 250mg | 357.18 Pln | |
| Fluorochem | 500mg | 659.16 Pln | |
| Fluorochem | 1g | 810.15 Pln | |
| Fluorochem | 2.5g | 1939.96 Pln | |
| Fluorochem | 5g | 2455.40 Pln | |
| Fluorochem | 10g | 4855.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-(2-pyrrolidin-1-ylethoxy)aniline (CAS 50609-01-3) is a chemical compound with the molecular formula C12H18N2O and a molecular weight of 206.28 g/mol. IUPAC name: 4-(2-pyrrolidin-1-ylethoxy)aniline. InChIKey: OTYZNDKWNPQQJP-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O |
|---|---|
| Molecular weight | 206.28 g/mol |
| IUPAC name | 4-(2-pyrrolidin-1-ylethoxy)aniline |
| InChIKey | OTYZNDKWNPQQJP-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)CCOC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)