cas: 216959-94-3 — see every product listed under this CAS number, including other names
4-(2-amino-1,3-thiazol-4-yl)benzoic acid, 95%, 95% (CAS 216959-94-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114JYU-100mg |
| cas | 216959-94-3 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 227.60 Pln | |
| Chemat | 5g | 875.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-(2-amino-1,3-thiazol-4-yl)benzoic acid (CAS 216959-94-3) is a chemical compound with the molecular formula C10H8N2O2S and a molecular weight of 220.25 g/mol. IUPAC name: 4-(2-amino-1,3-thiazol-4-yl)benzoic acid. InChIKey: DGZPYJBDYGAEBE-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O2S |
|---|---|
| Molecular weight | 220.25 g/mol |
| IUPAC name | 4-(2-amino-1,3-thiazol-4-yl)benzoic acid |
| InChIKey | DGZPYJBDYGAEBE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CSC(=N2)N)C(=O)O |
Computed by PubChem (NCBI)