cas: 817186-93-9 — see every product listed under this CAS number, including other names
4-(3,4-Dichlorophenoxy)piperidine hydrochloride 98% (CAS 817186-93-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A149928-100mg |
| cas | 817186-93-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 142.31 Pln | |
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 487.19 Pln | |
| Ambeed | 5g | 1616.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A149928 |
4-(3,4-dichlorophenoxy)piperidine;hydrochloride (CAS 817186-93-9) is a chemical compound with the molecular formula C11H14Cl3NO and a molecular weight of 282.6 g/mol. IUPAC name: 4-(3,4-dichlorophenoxy)piperidine;hydrochloride. InChIKey: SEBWUBGSEJJPSY-UHFFFAOYSA-N.
| Molecular formula | C11H14Cl3NO |
|---|---|
| Molecular weight | 282.6 g/mol |
| IUPAC name | 4-(3,4-dichlorophenoxy)piperidine;hydrochloride |
| InChIKey | SEBWUBGSEJJPSY-UHFFFAOYSA-N |
| SMILES | C1CNCCC1OC2=CC(=C(C=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)