CAS 817186-93-9 appears in our catalog under these names: 4-(3,4-Dichlorophenoxy)piperidine hydrochloride, 95%, 4-(3,4-Dichlorophenoxy)piperidine hydrochloride, 98%, 98%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 10g, 5g, 25g, 100mg, 250mg.
4-(3,4-dichlorophenoxy)piperidine;hydrochloride (CAS 817186-93-9) is a chemical compound with the molecular formula C11H14Cl3NO and a molecular weight of 282.6 g/mol. IUPAC name: 4-(3,4-dichlorophenoxy)piperidine;hydrochloride. InChIKey: SEBWUBGSEJJPSY-UHFFFAOYSA-N.
| Molecular formula | C11H14Cl3NO |
|---|---|
| Molecular weight | 282.6 g/mol |
| IUPAC name | 4-(3,4-dichlorophenoxy)piperidine;hydrochloride |
| InChIKey | SEBWUBGSEJJPSY-UHFFFAOYSA-N |
| SMILES | C1CNCCC1OC2=CC(=C(C=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)