cas: 817186-93-9 — see every product listed under this CAS number, including other names
4-(3,4-Dichlorophenoxy)piperidine hydrochloride, 98%, 98% (CAS 817186-93-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11629P-100mg |
| cas | 817186-93-9 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 309.20 Pln | |
| Chemat | 5g | 1034.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-(3,4-dichlorophenoxy)piperidine;hydrochloride (CAS 817186-93-9) is a chemical compound with the molecular formula C11H14Cl3NO and a molecular weight of 282.6 g/mol. IUPAC name: 4-(3,4-dichlorophenoxy)piperidine;hydrochloride. InChIKey: SEBWUBGSEJJPSY-UHFFFAOYSA-N.
| Molecular formula | C11H14Cl3NO |
|---|---|
| Molecular weight | 282.6 g/mol |
| IUPAC name | 4-(3,4-dichlorophenoxy)piperidine;hydrochloride |
| InChIKey | SEBWUBGSEJJPSY-UHFFFAOYSA-N |
| SMILES | C1CNCCC1OC2=CC(=C(C=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)