cas: 52203-73-3 — see every product listed under this CAS number, including other names
4-(3,5-Dioxo-1,2,4-triazolidin-4-yl)benzoic acid, 97% (CAS 52203-73-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A468074-1g |
| cas | 52203-73-3 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 13695.43 Pln | |
| Fluorochem | 100mg | 685.19 Pln | |
| Fluorochem | 250mg | 1497.41 Pln | |
| Fluorochem | 1g | 3923.64 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-(3,5-dioxo-1,2,4-triazolidin-4-yl)benzoic acid (CAS 52203-73-3) is a chemical compound with the molecular formula C9H7N3O4 and a molecular weight of 221.17 g/mol. IUPAC name: 4-(3,5-dioxo-1,2,4-triazolidin-4-yl)benzoic acid. InChIKey: ZLBYKGYCWFRLGM-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O4 |
|---|---|
| Molecular weight | 221.17 g/mol |
| IUPAC name | 4-(3,5-dioxo-1,2,4-triazolidin-4-yl)benzoic acid |
| InChIKey | ZLBYKGYCWFRLGM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)N2C(=O)NNC2=O |
Computed by PubChem (NCBI)