Products 1221794-83-7
CAS 1221794-83-7 is the registry number for (Z)-Methyl 2-cyano-2-(5-nitropyridin-2(1H)-ylidene)acetate, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 100g, 1g.
Methyl (2Z)-2-cyano-2-(5-nitro-1H-pyridin-2-ylidene)acetate (CAS 1221794-83-7) is a chemical compound with the molecular formula C9H7N3O4 and a molecular weight of 221.17 g/mol. IUPAC name: methyl (2Z)-2-cyano-2-(5-nitro-1H-pyridin-2-ylidene)acetate. InChIKey: YCCVKFVOTUBORA-FPLPWBNLSA-N.
| Molecular formula | C9H7N3O4 |
|---|---|
| Molecular weight | 221.17 g/mol |
| IUPAC name | methyl (2Z)-2-cyano-2-(5-nitro-1H-pyridin-2-ylidene)acetate |
| InChIKey | YCCVKFVOTUBORA-FPLPWBNLSA-N |
| SMILES | COC(=O)/C(=C\1/C=CC(=CN1)[N+](=O)[O-])/C#N |
Computed by PubChem (NCBI)