CAS 449210-08-6 is the registry number for 1-Methyl-2,4-dioxo-1,2,3,4-tetrahydropyrido[2,3-d]pyrimidine-6-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxylic acid (CAS 449210-08-6) is a chemical compound with the molecular formula C9H7N3O4 and a molecular weight of 221.17 g/mol. IUPAC name: 1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxylic acid. InChIKey: PCYVJFDNRGIOSC-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O4 |
|---|---|
| Molecular weight | 221.17 g/mol |
| IUPAC name | 1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxylic acid |
| InChIKey | PCYVJFDNRGIOSC-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=N2)C(=O)O)C(=O)NC1=O |
Computed by PubChem (NCBI)