cas: 28033-33-2 — see every product listed under this CAS number, including other names
4-(3-(Trifluoromethyl)phenoxy)piperidine hydrochloride, 95% (CAS 28033-33-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A752166-250mg |
| cas | 28033-33-2 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 1372.00 Pln | |
| AmBeed | 5g | 7888.51 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-[3-(trifluoromethyl)phenoxy]piperidine;hydrochloride (CAS 28033-33-2) is a chemical compound with the molecular formula C12H15ClF3NO and a molecular weight of 281.70 g/mol. IUPAC name: 4-[3-(trifluoromethyl)phenoxy]piperidine;hydrochloride. InChIKey: UCMHLADZICGHSS-UHFFFAOYSA-N.
| Molecular formula | C12H15ClF3NO |
|---|---|
| Molecular weight | 281.70 g/mol |
| IUPAC name | 4-[3-(trifluoromethyl)phenoxy]piperidine;hydrochloride |
| InChIKey | UCMHLADZICGHSS-UHFFFAOYSA-N |
| SMILES | C1CNCCC1OC2=CC=CC(=C2)C(F)(F)F.Cl |
Computed by PubChem (NCBI)