cas: 28033-33-2 — see every product listed under this CAS number, including other names
4-(3-(Trifluoromethyl)phenoxy)piperidine hydrochloride, 97% (CAS 28033-33-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F762938-1G |
| cas | 28033-33-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1841.04 Pln | |
| Fluorochem | 5g | 5355.42 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-[3-(trifluoromethyl)phenoxy]piperidine;hydrochloride (CAS 28033-33-2) is a chemical compound with the molecular formula C12H15ClF3NO and a molecular weight of 281.70 g/mol. IUPAC name: 4-[3-(trifluoromethyl)phenoxy]piperidine;hydrochloride. InChIKey: UCMHLADZICGHSS-UHFFFAOYSA-N.
| Molecular formula | C12H15ClF3NO |
|---|---|
| Molecular weight | 281.70 g/mol |
| IUPAC name | 4-[3-(trifluoromethyl)phenoxy]piperidine;hydrochloride |
| InChIKey | UCMHLADZICGHSS-UHFFFAOYSA-N |
| SMILES | C1CNCCC1OC2=CC=CC(=C2)C(F)(F)F.Cl |
Computed by PubChem (NCBI)