4-(3-Chlorophenyl)piperidine hydrochloride, 97%
cas: 99329-70-1 — see every product listed under this CAS number, including other names
4-(3-Chlorophenyl)piperidine hydrochloride, 97% (CAS 99329-70-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A151207-250mg |
| cas | 99329-70-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 181.25 Pln | |
| Ambeed | 1g | 231.31 Pln | |
| Ambeed | 5g | 704.12 Pln | |
| BLDpharm | 250mg | 153.30 Pln | |
| BLDpharm | 1g | 247.72 Pln | |
| BLDpharm | 5g | 753.09 Pln | |
| Fluorochem | 250mg | 102.06 Pln | |
| Fluorochem | 1g | 227.02 Pln | |
| Fluorochem | 5g | 726.85 Pln | |
| Fluorochem | 10g | 1247.50 Pln | |
| Fluorochem | 25g | 2991.67 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
4-(3-chlorophenyl)piperidine;hydrochloride (CAS 99329-70-1) is a chemical compound with the molecular formula C11H15Cl2N and a molecular weight of 232.15 g/mol. IUPAC name: 4-(3-chlorophenyl)piperidine;hydrochloride. InChIKey: SAXMEDYZBPHVLK-UHFFFAOYSA-N.
| Molecular formula | C11H15Cl2N |
|---|---|
| Molecular weight | 232.15 g/mol |
| IUPAC name | 4-(3-chlorophenyl)piperidine;hydrochloride |
| InChIKey | SAXMEDYZBPHVLK-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C2=CC(=CC=C2)Cl.Cl |
Computed by PubChem (NCBI)
Synonyms:
4-(3-Chlorophenyl)piperidine--hydrogen chloride (1/1), 4-(3-Chlorophenyl)piperidine hydrochloride, 4-(3-chlorophenyl)piperidine hcl, Piperidine, 4-(3-chlorophenyl)-, hydrochloride, 4-(3-chlorophenyl)piperidine;hydrochloride, 4-(3-chloro-phenyl)-piperidine hydrochloride, 4-(3-chloro-p, 4-(3-chloro-phenyl)-piperidine hcl salt, 4-(3-Chlorophenyl)piperidinehydrochloride, SAXMEDYZBPHVLK-UHFFFAOYSA-N