cas: 99329-70-1 — see every product listed under this CAS number, including other names
Piperidine, 4-(3-chlorophenyl)-, hydrochloride (1:1), 97%, 97% (CAS 99329-70-1) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116SQJ-25g |
| cas | 99329-70-1 |
| size | 25g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 2200.40 Pln | |
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 179.60 Pln | |
| Chemat | 5g | 491.60 Pln | |
| Chemat | 10g | 918.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-(3-chlorophenyl)piperidine;hydrochloride (CAS 99329-70-1) is a chemical compound with the molecular formula C11H15Cl2N and a molecular weight of 232.15 g/mol. IUPAC name: 4-(3-chlorophenyl)piperidine;hydrochloride. InChIKey: SAXMEDYZBPHVLK-UHFFFAOYSA-N.
| Molecular formula | C11H15Cl2N |
|---|---|
| Molecular weight | 232.15 g/mol |
| IUPAC name | 4-(3-chlorophenyl)piperidine;hydrochloride |
| InChIKey | SAXMEDYZBPHVLK-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C2=CC(=CC=C2)Cl.Cl |
Computed by PubChem (NCBI)