cas: 218301-62-3 — see every product listed under this CAS number, including other names
4-(3-FLUORO-4-NITROPHENYL)MORPHOLINE, 98% (CAS 218301-62-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F387256-100MG |
| cas | 218301-62-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 341.56 Pln | |
| Fluorochem | 250mg | 497.76 Pln | |
| Fluorochem | 1g | 1080.89 Pln | |
| Fluorochem | 5g | 2809.45 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
4-(3-fluoro-4-nitrophenyl)morpholine (CAS 218301-62-3) is a chemical compound with the molecular formula C10H11FN2O3 and a molecular weight of 226.20 g/mol. IUPAC name: 4-(3-fluoro-4-nitrophenyl)morpholine. InChIKey: OQVXZXWWCKAODG-UHFFFAOYSA-N.
| Molecular formula | C10H11FN2O3 |
|---|---|
| Molecular weight | 226.20 g/mol |
| IUPAC name | 4-(3-fluoro-4-nitrophenyl)morpholine |
| InChIKey | OQVXZXWWCKAODG-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=CC(=C(C=C2)[N+](=O)[O-])F |
Computed by PubChem (NCBI)