CAS 1233955-40-2 appears in our catalog under these names: 4-(2-Fluoro-6-nitrophenyl)morpholine, 97%, 4-(2-Fluoro-6-nitrophenyl)morpholine, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 250mg, 1g.
4-(2-fluoro-6-nitrophenyl)morpholine (CAS 1233955-40-2) is a chemical compound with the molecular formula C10H11FN2O3 and a molecular weight of 226.20 g/mol. IUPAC name: 4-(2-fluoro-6-nitrophenyl)morpholine. InChIKey: RVPOFXBMBJKJJK-UHFFFAOYSA-N.
| Molecular formula | C10H11FN2O3 |
|---|---|
| Molecular weight | 226.20 g/mol |
| IUPAC name | 4-(2-fluoro-6-nitrophenyl)morpholine |
| InChIKey | RVPOFXBMBJKJJK-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=C(C=CC=C2F)[N+](=O)[O-] |
Computed by PubChem (NCBI)