CAS 1233093-70-3 appears in our catalog under these names: Linezolid Impurity 34, 4-(2-Fluoro-5-nitrophenyl)morpholine, 95%, 4-(2-Fluoro-5-nitrophenyl)morpholine. Offered by: Chemat Brand, AmBeed, Biosynth. Available pack sizes: on request, 5g, 0,5g, 50mg.
4-(2-fluoro-5-nitrophenyl)morpholine (CAS 1233093-70-3) is a chemical compound with the molecular formula C10H11FN2O3 and a molecular weight of 226.20 g/mol. IUPAC name: 4-(2-fluoro-5-nitrophenyl)morpholine. InChIKey: QAGRLLGFZROGAS-UHFFFAOYSA-N.
| Molecular formula | C10H11FN2O3 |
|---|---|
| Molecular weight | 226.20 g/mol |
| IUPAC name | 4-(2-fluoro-5-nitrophenyl)morpholine |
| InChIKey | QAGRLLGFZROGAS-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=C(C=CC(=C2)[N+](=O)[O-])F |
Computed by PubChem (NCBI)