cas: 40503-87-5 — see every product listed under this CAS number, including other names
4-(3-Fluorophenyl)cyclohexanone, 95%, 95% (CAS 40503-87-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C8NY-250mg |
| cas | 40503-87-5 |
| size | 250mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 174.80 Pln | |
| Chemat | 25g | 602.00 Pln | |
| Chemat | 100g | 1850.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-(3-fluorophenyl)cyclohexan-1-one (CAS 40503-87-5) is a chemical compound with the molecular formula C12H13FO and a molecular weight of 192.23 g/mol. IUPAC name: 4-(3-fluorophenyl)cyclohexan-1-one. InChIKey: LIAPPURFKRACQO-UHFFFAOYSA-N.
| Molecular formula | C12H13FO |
|---|---|
| Molecular weight | 192.23 g/mol |
| IUPAC name | 4-(3-fluorophenyl)cyclohexan-1-one |
| InChIKey | LIAPPURFKRACQO-UHFFFAOYSA-N |
| SMILES | C1CC(=O)CCC1C2=CC(=CC=C2)F |
Computed by PubChem (NCBI)