Products 2676863-93-5
CAS 2676863-93-5 is the registry number for 5-Fluoro-6-isopropyl-2,3-dihydro-1H-inden-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-fluoro-6-propan-2-yl-2,3-dihydroinden-1-one (CAS 2676863-93-5) is a chemical compound with the molecular formula C12H13FO and a molecular weight of 192.23 g/mol. IUPAC name: 5-fluoro-6-propan-2-yl-2,3-dihydroinden-1-one. InChIKey: NAUWZUVEWGRUEC-UHFFFAOYSA-N.
| Molecular formula | C12H13FO |
|---|---|
| Molecular weight | 192.23 g/mol |
| IUPAC name | 5-fluoro-6-propan-2-yl-2,3-dihydroinden-1-one |
| InChIKey | NAUWZUVEWGRUEC-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C=C2CCC(=O)C2=C1)F |
Computed by PubChem (NCBI)