Products 149455-96-9
CAS 149455-96-9 is the registry number for 6-Fluoro-2,2-dimethyl-3,4-dihydronaphthalen-1(2H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-fluoro-2,2-dimethyl-3,4-dihydronaphthalen-1-one (CAS 149455-96-9) is a chemical compound with the molecular formula C12H13FO and a molecular weight of 192.23 g/mol. IUPAC name: 6-fluoro-2,2-dimethyl-3,4-dihydronaphthalen-1-one. InChIKey: HRGXUPOVBZNHEM-UHFFFAOYSA-N.
| Molecular formula | C12H13FO |
|---|---|
| Molecular weight | 192.23 g/mol |
| IUPAC name | 6-fluoro-2,2-dimethyl-3,4-dihydronaphthalen-1-one |
| InChIKey | HRGXUPOVBZNHEM-UHFFFAOYSA-N |
| SMILES | CC1(CCC2=C(C1=O)C=CC(=C2)F)C |
Computed by PubChem (NCBI)