cas: 209863-09-2 — see every product listed under this CAS number, including other names
4-(3-Methoxyphenyl)benzaldehyde, 97% (CAS 209863-09-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 2.5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F014276-250MG |
| cas | 209863-09-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 133.30 Pln | |
| Fluorochem | 1g | 362.39 Pln | |
| Fluorochem | 2.5g | 830.98 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-(3-methoxyphenyl)benzaldehyde (CAS 209863-09-2) is a chemical compound with the molecular formula C14H12O2 and a molecular weight of 212.24 g/mol. IUPAC name: 4-(3-methoxyphenyl)benzaldehyde. InChIKey: LHVLDSOAJZLBMM-UHFFFAOYSA-N.
| Molecular formula | C14H12O2 |
|---|---|
| Molecular weight | 212.24 g/mol |
| IUPAC name | 4-(3-methoxyphenyl)benzaldehyde |
| InChIKey | LHVLDSOAJZLBMM-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=CC=C(C=C2)C=O |
Computed by PubChem (NCBI)