cas: 117977-18-1 — see every product listed under this CAS number, including other names
4-(3-Methoxypropoxy)-2,3-dimethylpyridine 1-oxide, 95%, 95% (CAS 117977-18-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1192D1-250mg |
| cas | 117977-18-1 |
| size | 250mg |
| availability | 0.25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 1547.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-(3-methoxypropoxy)-2,3-dimethyl-1-oxidopyridin-1-ium (CAS 117977-18-1) is a chemical compound with the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. IUPAC name: 4-(3-methoxypropoxy)-2,3-dimethyl-1-oxidopyridin-1-ium. InChIKey: NZQKWDSCDLYKDF-UHFFFAOYSA-N.
| Molecular formula | C11H17NO3 |
|---|---|
| Molecular weight | 211.26 g/mol |
| IUPAC name | 4-(3-methoxypropoxy)-2,3-dimethyl-1-oxidopyridin-1-ium |
| InChIKey | NZQKWDSCDLYKDF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C[N+](=C1C)[O-])OCCCOC |
Computed by PubChem (NCBI)