CAS 923281-89-4 appears in our catalog under these names: 2-Azaspiro[4.5]decane-2-acetic acid, 3-oxo-, 95%, 2–{3–oxo–2–azaspiro(4·5)decan–2–yl}acetic acid, 2-Azaspiro[4.5]decane-2-acetic acid, 3-oxo-, 95%, 95%, 2-(3-Oxo-2-azaspiro[4.5]Decan-2-yl)acetic acid, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 10mg, 50mg.
2-(3-oxo-2-azaspiro[4.5]decan-2-yl)acetic acid (CAS 923281-89-4) is a chemical compound with the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. IUPAC name: 2-(3-oxo-2-azaspiro[4.5]decan-2-yl)acetic acid. InChIKey: NGZHPMFLQDBHTQ-UHFFFAOYSA-N.
| Molecular formula | C11H17NO3 |
|---|---|
| Molecular weight | 211.26 g/mol |
| IUPAC name | 2-(3-oxo-2-azaspiro[4.5]decan-2-yl)acetic acid |
| InChIKey | NGZHPMFLQDBHTQ-UHFFFAOYSA-N |
| SMILES | C1CCC2(CC1)CC(=O)N(C2)CC(=O)O |
Computed by PubChem (NCBI)