CAS 609805-36-9 appears in our catalog under these names: (1R*,4R*)-4-(2-oxopyrrolidin-1-yl)cyclohexane-1-carboxylic acid, 95%, Rel-(1r,4r)-4-(2-oxopyrrolidin-1-yl)cyclohexane-1-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
4-(2-oxopyrrolidin-1-yl)cyclohexane-1-carboxylic acid (CAS 609805-36-9) is a chemical compound with the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. IUPAC name: 4-(2-oxopyrrolidin-1-yl)cyclohexane-1-carboxylic acid. InChIKey: DCBNBDWNIQBLEH-UHFFFAOYSA-N.
| Molecular formula | C11H17NO3 |
|---|---|
| Molecular weight | 211.26 g/mol |
| IUPAC name | 4-(2-oxopyrrolidin-1-yl)cyclohexane-1-carboxylic acid |
| InChIKey | DCBNBDWNIQBLEH-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1)C2CCC(CC2)C(=O)O |
Computed by PubChem (NCBI)