cas: 24126-82-7 — see every product listed under this CAS number, including other names
4-(3-Phenylallyl)phenol 97% (CAS 24126-82-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A534671-100mg |
| cas | 24126-82-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 359.25 Pln | |
| Ambeed | 250mg | 414.88 Pln | |
| Ambeed | 1g | 487.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A534671 |
4-[(E)-3-phenylprop-2-enyl]phenol (CAS 24126-82-7) is a chemical compound with the molecular formula C15H14O and a molecular weight of 210.27 g/mol. IUPAC name: 4-[(E)-3-phenylprop-2-enyl]phenol. InChIKey: YNPGXIGIEYOFEX-QPJJXVBHSA-N.
| Molecular formula | C15H14O |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | 4-[(E)-3-phenylprop-2-enyl]phenol |
| InChIKey | YNPGXIGIEYOFEX-QPJJXVBHSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/CC2=CC=C(C=C2)O |
Computed by PubChem (NCBI)