cas: 41605-31-6 — see every product listed under this CAS number, including other names
4-(3-TRIFLUOROMETHYLPHENOXY)ANILINE, 95%, 95% (CAS 41605-31-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C958-250mg |
| cas | 41605-31-6 |
| size | 250mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 323.60 Pln | |
| Chemat | 1g | 587.60 Pln | |
| Chemat | 5g | 1638.80 Pln | |
| Chemat | 10g | 2421.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-[3-(trifluoromethyl)phenoxy]aniline (CAS 41605-31-6) is a chemical compound with the molecular formula C13H10F3NO and a molecular weight of 253.22 g/mol. IUPAC name: 4-[3-(trifluoromethyl)phenoxy]aniline. InChIKey: VPVKXXRMSWUGHE-UHFFFAOYSA-N.
| Molecular formula | C13H10F3NO |
|---|---|
| Molecular weight | 253.22 g/mol |
| IUPAC name | 4-[3-(trifluoromethyl)phenoxy]aniline |
| InChIKey | VPVKXXRMSWUGHE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC2=CC=C(C=C2)N)C(F)(F)F |
Computed by PubChem (NCBI)