CAS 1261767-88-7 appears in our catalog under these names: 5-Methyl-2-(4-(trifluoromethoxy)phenyl)pyridine, 95%, 5-Methyl-2-(4-(trifluoromethoxy)phenyl)pyridine, 97%, 5-Methyl-2-(4-(trifluoromethoxy)phenyl)pyridine. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 25g, 10g, 100g, 1g, 5g.
5-methyl-2-[4-(trifluoromethoxy)phenyl]pyridine (CAS 1261767-88-7) is a chemical compound with the molecular formula C13H10F3NO and a molecular weight of 253.22 g/mol. IUPAC name: 5-methyl-2-[4-(trifluoromethoxy)phenyl]pyridine. InChIKey: JALMAQGNJWSABQ-UHFFFAOYSA-N.
| Molecular formula | C13H10F3NO |
|---|---|
| Molecular weight | 253.22 g/mol |
| IUPAC name | 5-methyl-2-[4-(trifluoromethoxy)phenyl]pyridine |
| InChIKey | JALMAQGNJWSABQ-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(C=C1)C2=CC=C(C=C2)OC(F)(F)F |
Computed by PubChem (NCBI)