CAS 106877-21-8 appears in our catalog under these names: 4-Phenoxy-2-(trifluoromethyl)aniline, 95%, 4–Phenoxy–2–(Trifluoromethyl)Aniline, 4-Phenoxy-2-(trifluoromethyl)aniline. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat. Available pack sizes: 25g, 250mg, 5g, 1g, 100mg, 10g, 10mg.
4-phenoxy-2-(trifluoromethyl)aniline (CAS 106877-21-8) is a chemical compound with the molecular formula C13H10F3NO and a molecular weight of 253.22 g/mol. IUPAC name: 4-phenoxy-2-(trifluoromethyl)aniline. InChIKey: CWKQMUBTZIPBLG-UHFFFAOYSA-N.
| Molecular formula | C13H10F3NO |
|---|---|
| Molecular weight | 253.22 g/mol |
| IUPAC name | 4-phenoxy-2-(trifluoromethyl)aniline |
| InChIKey | CWKQMUBTZIPBLG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC(=C(C=C2)N)C(F)(F)F |
Computed by PubChem (NCBI)