cas: 325808-20-6 — see every product listed under this CAS number, including other names
4-(3-methoxyphenyl)piperidine,hydrochloride, 97% (CAS 325808-20-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F609900-250MG |
| cas | 325808-20-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1049.65 Pln | |
| Fluorochem | 500mg | 1637.98 Pln | |
| Fluorochem | 1g | 2569.95 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-(3-methoxyphenyl)piperidine;hydrochloride (CAS 325808-20-6) is a chemical compound with the molecular formula C12H18ClNO and a molecular weight of 227.73 g/mol. IUPAC name: 4-(3-methoxyphenyl)piperidine;hydrochloride. InChIKey: UFIHUSFFAGVMDG-UHFFFAOYSA-N.
| Molecular formula | C12H18ClNO |
|---|---|
| Molecular weight | 227.73 g/mol |
| IUPAC name | 4-(3-methoxyphenyl)piperidine;hydrochloride |
| InChIKey | UFIHUSFFAGVMDG-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2CCNCC2.Cl |
Computed by PubChem (NCBI)