cas: 851883-08-4 — see every product listed under this CAS number, including other names
4-(4,4,5,5-Tetramethyl-1,3,2-Dioxaborolan-2-Yl)Benzene-1,2-Diamine, 97%, 97% (CAS 851883-08-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119FYS-100mg |
| cas | 851883-08-4 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 458.00 Pln | |
| Chemat | 250mg | 659.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,2-diamine (CAS 851883-08-4) is a chemical compound with the molecular formula C12H19BN2O2 and a molecular weight of 234.10 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,2-diamine. InChIKey: SVUDHDDKOKWBNK-UHFFFAOYSA-N.
| Molecular formula | C12H19BN2O2 |
|---|---|
| Molecular weight | 234.10 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,2-diamine |
| InChIKey | SVUDHDDKOKWBNK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)N)N |
Computed by PubChem (NCBI)