cas: 1255309-13-7 — see every product listed under this CAS number, including other names
4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-carbazole 97% (CAS 1255309-13-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1000945-250mg |
| cas | 1255309-13-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 654.06 Pln | |
| Ambeed | 25g | 2105.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1000945 |
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-carbazole (CAS 1255309-13-7) is a chemical compound with the molecular formula C18H20BNO2 and a molecular weight of 293.2 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-carbazole. InChIKey: BLFDNIPIBSFUEL-UHFFFAOYSA-N.
| Molecular formula | C18H20BNO2 |
|---|---|
| Molecular weight | 293.2 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-carbazole |
| InChIKey | BLFDNIPIBSFUEL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C4=CC=CC=C4NC3=CC=C2 |
Computed by PubChem (NCBI)