cas: 1088118-97-1 — see every product listed under this CAS number, including other names
4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[c][1,2,5]thiadiazole, 95%, 95% (CAS 1088118-97-1) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DN1S-10g |
| cas | 1088118-97-1 |
| size | 10g |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 8253.20 Pln | |
| Chemat | 100mg | 256.40 Pln | |
| Chemat | 250mg | 405.20 Pln | |
| Chemat | 1g | 1005.20 Pln | |
| Chemat | 5g | 4768.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,1,3-benzothiadiazole (CAS 1088118-97-1) is a chemical compound with the molecular formula C12H15BN2O2S and a molecular weight of 262.14 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,1,3-benzothiadiazole. InChIKey: FRUBQASVNDFUTD-UHFFFAOYSA-N.
| Molecular formula | C12H15BN2O2S |
|---|---|
| Molecular weight | 262.14 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,1,3-benzothiadiazole |
| InChIKey | FRUBQASVNDFUTD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC3=NSN=C23 |
Computed by PubChem (NCBI)