CAS 1326714-47-9 is the registry number for 7-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzo(d)(1,2,3)thiadiazole, 97%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3-benzothiadiazole (CAS 1326714-47-9) is a chemical compound with the molecular formula C12H15BN2O2S and a molecular weight of 262.14 g/mol. IUPAC name: 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3-benzothiadiazole. InChIKey: FDNYFCBEKUDAMW-UHFFFAOYSA-N.
| Molecular formula | C12H15BN2O2S |
|---|---|
| Molecular weight | 262.14 g/mol |
| IUPAC name | 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3-benzothiadiazole |
| InChIKey | FDNYFCBEKUDAMW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C(=CC=C2)N=NS3 |
Computed by PubChem (NCBI)