Products 2766230-86-6
CAS 2766230-86-6 is the registry number for 7-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)isothiazolo[4,5-b]pyridine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1,2]thiazolo[4,5-b]pyridine (CAS 2766230-86-6) is a chemical compound with the molecular formula C12H15BN2O2S and a molecular weight of 262.14 g/mol. IUPAC name: 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1,2]thiazolo[4,5-b]pyridine. InChIKey: XBQKZIQSJHFULM-UHFFFAOYSA-N.
| Molecular formula | C12H15BN2O2S |
|---|---|
| Molecular weight | 262.14 g/mol |
| IUPAC name | 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1,2]thiazolo[4,5-b]pyridine |
| InChIKey | XBQKZIQSJHFULM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C(=NC=C2)C=NS3 |
Computed by PubChem (NCBI)