cas: 928664-98-6 — see every product listed under this CAS number, including other names
4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)isoxazole, 98%, 98% (CAS 928664-98-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1144SX-250mg |
| cas | 928664-98-6 |
| size | 250mg |
| availability | 5000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 102.80 Pln | |
| Chemat | 5g | 237.20 Pln | |
| Chemat | 10g | 357.20 Pln | |
| Chemat | 25g | 650.00 Pln | |
| Chemat | 50g | 1062.80 Pln | |
| Chemat | 100g | 1782.80 Pln | |
| Chemat | 250g | 4197.20 Pln | |
| Chemat | 500g | 4555.20 Pln | |
| Chemat | 1kg | 8296.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-oxazole (CAS 928664-98-6) is a chemical compound with the molecular formula C9H14BNO3 and a molecular weight of 195.03 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-oxazole. InChIKey: LXCICYRNWIGDQA-UHFFFAOYSA-N.
| Molecular formula | C9H14BNO3 |
|---|---|
| Molecular weight | 195.03 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-oxazole |
| InChIKey | LXCICYRNWIGDQA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CON=C2 |
Computed by PubChem (NCBI)